C16H11Cl2NO — CID 103139219
(3,5-dichlorophenyl)-isoquinolin-8-ylmethanol (PubChem CID 103139219) has the molecular formula C16H11Cl2NO and a molecular weight of 304.18 g/mol. Its IUPAC name is (3,5-dichlorophenyl)-isoquinolin-8-ylmethanol.
| Compound Name | (3,5-dichlorophenyl)-isoquinolin-8-ylmethanol |
|---|---|
| PubChem CID | 103139219 |
| Molecular Formula | C16H11Cl2NO |
| Molecular Weight | 304.18 g/mol |
| Exact Mass | 303.02 |
| IUPAC Name | (3,5-dichlorophenyl)-isoquinolin-8-ylmethanol |
| SMILES | OC(c1cc(Cl)cc(Cl)c1)c1cccc2ccncc12 |
| InChI | InChI=1S/C16H11Cl2NO/c17-12-6-11(7-13(18)8-12)16(20)14-3-1-2-10-4-5-19-9-15(10)14/h1-9,16,20H |
| InChIKey | UWMIDAAYSHUPIA-UHFFFAOYSA-N |
| XLogP | 4.62 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.18 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |