C16H10F3NO — CID 103139324
isoquinolin-8-yl-(3,4,5-trifluorophenyl)methanol (PubChem CID 103139324) has the molecular formula C16H10F3NO and a molecular weight of 289.26 g/mol. Its IUPAC name is isoquinolin-8-yl-(3,4,5-trifluorophenyl)methanol.
| Compound Name | isoquinolin-8-yl-(3,4,5-trifluorophenyl)methanol |
|---|---|
| PubChem CID | 103139324 |
| Molecular Formula | C16H10F3NO |
| Molecular Weight | 289.26 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | isoquinolin-8-yl-(3,4,5-trifluorophenyl)methanol |
| SMILES | OC(c1cc(F)c(F)c(F)c1)c1cccc2ccncc12 |
| InChI | InChI=1S/C16H10F3NO/c17-13-6-10(7-14(18)15(13)19)16(21)11-3-1-2-9-4-5-20-8-12(9)11/h1-8,16,21H |
| InChIKey | MGLDACBYZSQKDI-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.26 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|