C16H11F2NO — CID 62813501
(3,4-difluorophenyl)-isoquinolin-5-ylmethanol (PubChem CID 62813501) has the molecular formula C16H11F2NO and a molecular weight of 271.27 g/mol. Its IUPAC name is (3,4-difluorophenyl)-isoquinolin-5-ylmethanol.
| Compound Name | (3,4-difluorophenyl)-isoquinolin-5-ylmethanol |
|---|---|
| PubChem CID | 62813501 |
| Molecular Formula | C16H11F2NO |
| Molecular Weight | 271.27 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | (3,4-difluorophenyl)-isoquinolin-5-ylmethanol |
| SMILES | OC(c1ccc(F)c(F)c1)c1cccc2cnccc12 |
| InChI | InChI=1S/C16H11F2NO/c17-14-5-4-10(8-15(14)18)16(20)13-3-1-2-11-9-19-7-6-12(11)13/h1-9,16,20H |
| InChIKey | FFYBPMZHCXZEPS-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.27 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |