C15H20N4 — CID 103140093
[(1-methylpyrazol-3-yl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine (PubChem CID 103140093) has the molecular formula C15H20N4 and a molecular weight of 256.35 g/mol. Its IUPAC name is [(1-methylpyrazol-3-yl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine.
| Compound Name | [(1-methylpyrazol-3-yl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 103140093 |
| Molecular Formula | C15H20N4 |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.17 |
| IUPAC Name | [(1-methylpyrazol-3-yl)-(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine |
| SMILES | Cn1ccc(C(NN)C2CCCc3ccccc32)n1 |
| InChI | InChI=1S/C15H20N4/c1-19-10-9-14(18-19)15(17-16)13-8-4-6-11-5-2-3-7-12(11)13/h2-3,5,7,9-10,13,15,17H,4,6,8,16H2,1H3 |
| InChIKey | GAXJGPWWEIVUGC-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|