C15H18N4 — CID 105218815
[pyrimidin-5-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine (PubChem CID 105218815) has the molecular formula C15H18N4 and a molecular weight of 254.34 g/mol. Its IUPAC name is [pyrimidin-5-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine.
| Compound Name | [pyrimidin-5-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105218815 |
| Molecular Formula | C15H18N4 |
| Molecular Weight | 254.34 g/mol |
| Exact Mass | 254.15 |
| IUPAC Name | [pyrimidin-5-yl(1,2,3,4-tetrahydronaphthalen-1-yl)methyl]hydrazine |
| SMILES | NNC(c1cncnc1)C1CCCc2ccccc21 |
| InChI | InChI=1S/C15H18N4/c16-19-15(12-8-17-10-18-9-12)14-7-3-5-11-4-1-2-6-13(11)14/h1-2,4,6,8-10,14-15,19H,3,5,7,16H2 |
| InChIKey | UAMBLSJUNHWDEC-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 63.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.34 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|