C14H15F2N3O2 — CID 103146206
3-[2-(2,2-difluoroethoxy)ethyl]-5-[(2S)-2,3-dihydro-1H-indol-2-yl]-1,2,4-oxadiazole (PubChem CID 103146206) has the molecular formula C14H15F2N3O2 and a molecular weight of 295.29 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(2S)-2,3-dihydro-1H-indol-2-yl]-1,2,4-oxadiazole.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(2S)-2,3-dihydro-1H-indol-2-yl]-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 103146206 |
| Molecular Formula | C14H15F2N3O2 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-5-[(2S)-2,3-dihydro-1H-indol-2-yl]-1,2,4-oxadiazole |
| SMILES | FC(F)COCCc1noc([C@@H]2Cc3ccccc3N2)n1 |
| InChI | InChI=1S/C14H15F2N3O2/c15-12(16)8-20-6-5-13-18-14(21-19-13)11-7-9-3-1-2-4-10(9)17-11/h1-4,11-12,17H,5-8H2/t11-/m0/s1 |
| InChIKey | ATXFJPXTWRCAHV-NSHDSACASA-N |
| XLogP | 2.60 |
| TPSA | 60.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|