C13H19F2NO3S — CID 103146546
ethyl 2-[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-4-yl]-2-methylpropanoate (PubChem CID 103146546) has the molecular formula C13H19F2NO3S and a molecular weight of 307.36 g/mol. Its IUPAC name is ethyl 2-[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-4-yl]-2-methylpropanoate.
| Compound Name | ethyl 2-[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-4-yl]-2-methylpropanoate |
|---|---|
| PubChem CID | 103146546 |
| Molecular Formula | C13H19F2NO3S |
| Molecular Weight | 307.36 g/mol |
| Exact Mass | 307.11 |
| IUPAC Name | ethyl 2-[2-[2-(2,2-difluoroethoxy)ethyl]-1,3-thiazol-4-yl]-2-methylpropanoate |
| SMILES | CCOC(=O)C(C)(C)c1csc(CCOCC(F)F)n1 |
| InChI | InChI=1S/C13H19F2NO3S/c1-4-19-12(17)13(2,3)9-8-20-11(16-9)5-6-18-7-10(14)15/h8,10H,4-7H2,1-3H3 |
| InChIKey | FWDYQAKWNUGNEJ-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.36 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|