C13H18F3NO3S — CID 103146547
ethyl 2-methyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propanoate (PubChem CID 103146547) has the molecular formula C13H18F3NO3S and a molecular weight of 325.35 g/mol. Its IUPAC name is ethyl 2-methyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propanoate.
| Compound Name | ethyl 2-methyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propanoate |
|---|---|
| PubChem CID | 103146547 |
| Molecular Formula | C13H18F3NO3S |
| Molecular Weight | 325.35 g/mol |
| Exact Mass | 325.10 |
| IUPAC Name | ethyl 2-methyl-2-[2-[2-(2,2,2-trifluoroethoxy)ethyl]-1,3-thiazol-4-yl]propanoate |
| SMILES | CCOC(=O)C(C)(C)c1csc(CCOCC(F)(F)F)n1 |
| InChI | InChI=1S/C13H18F3NO3S/c1-4-20-11(18)12(2,3)9-7-21-10(17-9)5-6-19-8-13(14,15)16/h7H,4-6,8H2,1-3H3 |
| InChIKey | VKBKBBFHYYAXAC-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.35 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|