C6H9F2N3OS — CID 103146580
3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine (PubChem CID 103146580) has the molecular formula C6H9F2N3OS and a molecular weight of 209.22 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine |
|---|---|
| PubChem CID | 103146580 |
| Molecular Formula | C6H9F2N3OS |
| Molecular Weight | 209.22 g/mol |
| Exact Mass | 209.04 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-1,2,4-thiadiazol-5-amine |
| SMILES | Nc1nc(CCOCC(F)F)ns1 |
| InChI | InChI=1S/C6H9F2N3OS/c7-4(8)3-12-2-1-5-10-6(9)13-11-5/h4H,1-3H2,(H2,9,10,11) |
| InChIKey | PMXHOUZWKWULNY-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.22 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|