C6H7F2IN2OS — CID 103151212
3-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1,2,4-thiadiazole (PubChem CID 103151212) has the molecular formula C6H7F2IN2OS and a molecular weight of 320.10 g/mol. Its IUPAC name is 3-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1,2,4-thiadiazole.
| Compound Name | 3-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1,2,4-thiadiazole |
|---|---|
| PubChem CID | 103151212 |
| Molecular Formula | C6H7F2IN2OS |
| Molecular Weight | 320.10 g/mol |
| Exact Mass | 319.93 |
| IUPAC Name | 3-[2-(2,2-difluoroethoxy)ethyl]-5-iodo-1,2,4-thiadiazole |
| SMILES | FC(F)COCCc1nsc(I)n1 |
| InChI | InChI=1S/C6H7F2IN2OS/c7-4(8)3-12-2-1-5-10-6(9)13-11-5/h4H,1-3H2 |
| InChIKey | HWGGPFNBGPCBGV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.10 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|