C10H13F3N2O3 — CID 103146610
5-ethyl-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one (PubChem CID 103146610) has the molecular formula C10H13F3N2O3 and a molecular weight of 266.22 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one.
| Compound Name | 5-ethyl-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146610 |
| Molecular Formula | C10H13F3N2O3 |
| Molecular Weight | 266.22 g/mol |
| Exact Mass | 266.09 |
| IUPAC Name | 5-ethyl-4-hydroxy-2-[2-(2,2,2-trifluoroethoxy)ethyl]-1H-pyrimidin-6-one |
| SMILES | CCc1c(O)nc(CCOCC(F)(F)F)[nH]c1=O |
| InChI | InChI=1S/C10H13F3N2O3/c1-2-6-8(16)14-7(15-9(6)17)3-4-18-5-10(11,12)13/h2-5H2,1H3,(H2,14,15,16,17) |
| InChIKey | ZCQWPBVBKXYQAA-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.22 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|