C11H16F2N2O3 — CID 103146612
2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-propan-2-yl-1H-pyrimidin-6-one (PubChem CID 103146612) has the molecular formula C11H16F2N2O3 and a molecular weight of 262.26 g/mol. Its IUPAC name is 2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-propan-2-yl-1H-pyrimidin-6-one.
| Compound Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-propan-2-yl-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 103146612 |
| Molecular Formula | C11H16F2N2O3 |
| Molecular Weight | 262.26 g/mol |
| Exact Mass | 262.11 |
| IUPAC Name | 2-[2-(2,2-difluoroethoxy)ethyl]-4-hydroxy-5-propan-2-yl-1H-pyrimidin-6-one |
| SMILES | CC(C)c1c(O)nc(CCOCC(F)F)[nH]c1=O |
| InChI | InChI=1S/C11H16F2N2O3/c1-6(2)9-10(16)14-8(15-11(9)17)3-4-18-5-7(12)13/h6-7H,3-5H2,1-2H3,(H2,14,15,16,17) |
| InChIKey | OMMYKEPBHYRXIF-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.26 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|