C10H13ClF2N2O2 — CID 103146688
4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)pyrimidine (PubChem CID 103146688) has the molecular formula C10H13ClF2N2O2 and a molecular weight of 266.67 g/mol. Its IUPAC name is 4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)pyrimidine.
| Compound Name | 4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)pyrimidine |
|---|---|
| PubChem CID | 103146688 |
| Molecular Formula | C10H13ClF2N2O2 |
| Molecular Weight | 266.67 g/mol |
| Exact Mass | 266.06 |
| IUPAC Name | 4-chloro-2-[2-(2,2-difluoroethoxy)ethyl]-6-(methoxymethyl)pyrimidine |
| SMILES | COCc1cc(Cl)nc(CCOCC(F)F)n1 |
| InChI | InChI=1S/C10H13ClF2N2O2/c1-16-5-7-4-8(11)15-10(14-7)2-3-17-6-9(12)13/h4,9H,2-3,5-6H2,1H3 |
| InChIKey | ZTMNYTNWKCHRET-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.67 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|