C12H19F3O4S — CID 103146906
1-(3-methylsulfonylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-one (PubChem CID 103146906) has the molecular formula C12H19F3O4S and a molecular weight of 316.34 g/mol. Its IUPAC name is 1-(3-methylsulfonylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-one.
| Compound Name | 1-(3-methylsulfonylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
|---|---|
| PubChem CID | 103146906 |
| Molecular Formula | C12H19F3O4S |
| Molecular Weight | 316.34 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | 1-(3-methylsulfonylcyclohexyl)-3-(2,2,2-trifluoroethoxy)propan-1-one |
| SMILES | CS(=O)(=O)C1CCCC(C(=O)CCOCC(F)(F)F)C1 |
| InChI | InChI=1S/C12H19F3O4S/c1-20(17,18)10-4-2-3-9(7-10)11(16)5-6-19-8-12(13,14)15/h9-10H,2-8H2,1H3 |
| InChIKey | QZPITSDTVXUPBM-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.34 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|