C9H11F2NO2S — CID 103147227
4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-one (PubChem CID 103147227) has the molecular formula C9H11F2NO2S and a molecular weight of 235.25 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-one.
| Compound Name | 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-one |
|---|---|
| PubChem CID | 103147227 |
| Molecular Formula | C9H11F2NO2S |
| Molecular Weight | 235.25 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-1-(1,3-thiazol-5-yl)butan-2-one |
| SMILES | O=C(CCOCC(F)F)Cc1cncs1 |
| InChI | InChI=1S/C9H11F2NO2S/c10-9(11)5-14-2-1-7(13)3-8-4-12-6-15-8/h4,6,9H,1-3,5H2 |
| InChIKey | WOVIRNNDIVMRSN-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.25 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|