C9H9F4NO2S — CID 103473773
1-(2,2,3,3-tetrafluoropropoxy)-3-(1,3-thiazol-5-yl)propan-2-one (PubChem CID 103473773) has the molecular formula C9H9F4NO2S and a molecular weight of 271.23 g/mol. Its IUPAC name is 1-(2,2,3,3-tetrafluoropropoxy)-3-(1,3-thiazol-5-yl)propan-2-one.
| Compound Name | 1-(2,2,3,3-tetrafluoropropoxy)-3-(1,3-thiazol-5-yl)propan-2-one |
|---|---|
| PubChem CID | 103473773 |
| Molecular Formula | C9H9F4NO2S |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-(2,2,3,3-tetrafluoropropoxy)-3-(1,3-thiazol-5-yl)propan-2-one |
| SMILES | O=C(COCC(F)(F)C(F)F)Cc1cncs1 |
| InChI | InChI=1S/C9H9F4NO2S/c10-8(11)9(12,13)4-16-3-6(15)1-7-2-14-5-17-7/h2,5,8H,1,3-4H2 |
| InChIKey | WLOKSFBCZCBARH-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|