C9H8F5NO2S — CID 106782674
3-(2,2-difluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-one (PubChem CID 106782674) has the molecular formula C9H8F5NO2S and a molecular weight of 289.23 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-one.
| Compound Name | 3-(2,2-difluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-one |
|---|---|
| PubChem CID | 106782674 |
| Molecular Formula | C9H8F5NO2S |
| Molecular Weight | 289.23 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propan-1-one |
| SMILES | O=C(CCOCC(F)F)c1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C9H8F5NO2S/c10-7(11)4-17-2-1-5(16)6-3-15-8(18-6)9(12,13)14/h3,7H,1-2,4H2 |
| InChIKey | KAXSHGMKRHBBMH-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.23 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|