C9H9F4NO2S — CID 103476009
1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanone (PubChem CID 103476009) has the molecular formula C9H9F4NO2S and a molecular weight of 271.24 g/mol. Its IUPAC name is 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanone.
| Compound Name | 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanone |
|---|---|
| PubChem CID | 103476009 |
| Molecular Formula | C9H9F4NO2S |
| Molecular Weight | 271.24 g/mol |
| Exact Mass | 271.03 |
| IUPAC Name | 1-[2-(2,2,3,3-tetrafluoropropoxymethyl)-1,3-thiazol-5-yl]ethanone |
| SMILES | CC(=O)c1cnc(COCC(F)(F)C(F)F)s1 |
| InChI | InChI=1S/C9H9F4NO2S/c1-5(15)6-2-14-7(17-6)3-16-4-9(12,13)8(10)11/h2,8H,3-4H2,1H3 |
| InChIKey | BNOCIMIEYPBUIG-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.24 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|