C11H12BrF4NO — CID 103147983
1-(5-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103147983) has the molecular formula C11H12BrF4NO and a molecular weight of 330.12 g/mol. Its IUPAC name is 1-(5-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | 1-(5-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103147983 |
| Molecular Formula | C11H12BrF4NO |
| Molecular Weight | 330.12 g/mol |
| Exact Mass | 329.00 |
| IUPAC Name | 1-(5-bromo-2-fluorophenyl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | NC(CCOCC(F)(F)F)c1cc(Br)ccc1F |
| InChI | InChI=1S/C11H12BrF4NO/c12-7-1-2-9(13)8(5-7)10(17)3-4-18-6-11(14,15)16/h1-2,5,10H,3-4,6,17H2 |
| InChIKey | SVFXFJHSGPNNAK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.12 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|