C15H28F3NO2 — CID 103148477
N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine (PubChem CID 103148477) has the molecular formula C15H28F3NO2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine.
| Compound Name | N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
|---|---|
| PubChem CID | 103148477 |
| Molecular Formula | C15H28F3NO2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.21 |
| IUPAC Name | N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)-3-(2,2,2-trifluoroethoxy)propan-1-amine |
| SMILES | CCNC(CCOCC(F)(F)F)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H28F3NO2/c1-6-19-12(7-8-20-10-15(16,17)18)11-9-13(2,3)21-14(11,4)5/h11-12,19H,6-10H2,1-5H3 |
| InChIKey | BGPZHYBENOBDDT-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|