C15H29F2NO2 — CID 103149468
3-(2,2-difluoroethoxy)-N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine (PubChem CID 103149468) has the molecular formula C15H29F2NO2 and a molecular weight of 293.40 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 103149468 |
| Molecular Formula | C15H29F2NO2 |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-ethyl-1-(2,2,5,5-tetramethyloxolan-3-yl)propan-1-amine |
| SMILES | CCNC(CCOCC(F)F)C1CC(C)(C)OC1(C)C |
| InChI | InChI=1S/C15H29F2NO2/c1-6-18-12(7-8-19-10-13(16)17)11-9-14(2,3)20-15(11,4)5/h11-13,18H,6-10H2,1-5H3 |
| InChIKey | PJWONBNPIVGJDN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|