C9H15F2N3O — CID 103148829
3-(2,2-difluoroethoxy)-1-(1-methylpyrazol-3-yl)propan-1-amine (PubChem CID 103148829) has the molecular formula C9H15F2N3O and a molecular weight of 219.24 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(1-methylpyrazol-3-yl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(1-methylpyrazol-3-yl)propan-1-amine |
|---|---|
| PubChem CID | 103148829 |
| Molecular Formula | C9H15F2N3O |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(1-methylpyrazol-3-yl)propan-1-amine |
| SMILES | Cn1ccc(C(N)CCOCC(F)F)n1 |
| InChI | InChI=1S/C9H15F2N3O/c1-14-4-2-8(13-14)7(12)3-5-15-6-9(10)11/h2,4,7,9H,3,5-6,12H2,1H3 |
| InChIKey | AVFOQOVPFUFWIY-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|