C8H13F2N3O — CID 146569727
1-(2,2-difluoroethyl)-3-(2-methoxyethyl)pyrazol-4-amine (PubChem CID 146569727) has the molecular formula C8H13F2N3O and a molecular weight of 205.21 g/mol. Its IUPAC name is 1-(2,2-difluoroethyl)-3-(2-methoxyethyl)pyrazol-4-amine.
| Compound Name | 1-(2,2-difluoroethyl)-3-(2-methoxyethyl)pyrazol-4-amine |
|---|---|
| PubChem CID | 146569727 |
| Molecular Formula | C8H13F2N3O |
| Molecular Weight | 205.21 g/mol |
| Exact Mass | 205.10 |
| IUPAC Name | 1-(2,2-difluoroethyl)-3-(2-methoxyethyl)pyrazol-4-amine |
| SMILES | COCCc1nn(CC(F)F)cc1N |
| InChI | InChI=1S/C8H13F2N3O/c1-14-3-2-7-6(11)4-13(12-7)5-8(9)10/h4,8H,2-3,5,11H2,1H3 |
| InChIKey | PHMRURASQVUEOG-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.21 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |