C11H23F2NO — CID 103148880
1-(2,2-difluoroethoxy)-5-methyloctan-3-amine (PubChem CID 103148880) has the molecular formula C11H23F2NO and a molecular weight of 223.31 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-5-methyloctan-3-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-5-methyloctan-3-amine |
|---|---|
| PubChem CID | 103148880 |
| Molecular Formula | C11H23F2NO |
| Molecular Weight | 223.31 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-5-methyloctan-3-amine |
| SMILES | CCCC(C)CC(N)CCOCC(F)F |
| InChI | InChI=1S/C11H23F2NO/c1-3-4-9(2)7-10(14)5-6-15-8-11(12)13/h9-11H,3-8,14H2,1-2H3 |
| InChIKey | OAKSHAXNACAQEH-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.31 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|