C15H27F2NO2 — CID 103148924
3-(2,2-difluoroethoxy)-1-(1-oxaspiro[5.5]undecan-4-yl)propan-1-amine (PubChem CID 103148924) has the molecular formula C15H27F2NO2 and a molecular weight of 291.38 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-1-(1-oxaspiro[5.5]undecan-4-yl)propan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-1-(1-oxaspiro[5.5]undecan-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 103148924 |
| Molecular Formula | C15H27F2NO2 |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-1-(1-oxaspiro[5.5]undecan-4-yl)propan-1-amine |
| SMILES | NC(CCOCC(F)F)C1CCOC2(CCCCC2)C1 |
| InChI | InChI=1S/C15H27F2NO2/c16-14(17)11-19-8-5-13(18)12-4-9-20-15(10-12)6-2-1-3-7-15/h12-14H,1-11,18H2 |
| InChIKey | XQLPDCOHRBQYMT-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|