C10H21F2NO — CID 103148967
1-(2,2-difluoroethoxy)-6-methylheptan-3-amine (PubChem CID 103148967) has the molecular formula C10H21F2NO and a molecular weight of 209.28 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-6-methylheptan-3-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-6-methylheptan-3-amine |
|---|---|
| PubChem CID | 103148967 |
| Molecular Formula | C10H21F2NO |
| Molecular Weight | 209.28 g/mol |
| Exact Mass | 209.16 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-6-methylheptan-3-amine |
| SMILES | CC(C)CCC(N)CCOCC(F)F |
| InChI | InChI=1S/C10H21F2NO/c1-8(2)3-4-9(13)5-6-14-7-10(11)12/h8-10H,3-7,13H2,1-2H3 |
| InChIKey | XMOSKDYKPBUIPU-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.28 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|