C13H27F2NO — CID 103149078
1-(2,2-difluoroethoxy)-5-ethylnonan-3-amine (PubChem CID 103149078) has the molecular formula C13H27F2NO and a molecular weight of 251.36 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-5-ethylnonan-3-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-5-ethylnonan-3-amine |
|---|---|
| PubChem CID | 103149078 |
| Molecular Formula | C13H27F2NO |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-5-ethylnonan-3-amine |
| SMILES | CCCCC(CC)CC(N)CCOCC(F)F |
| InChI | InChI=1S/C13H27F2NO/c1-3-5-6-11(4-2)9-12(16)7-8-17-10-13(14)15/h11-13H,3-10,16H2,1-2H3 |
| InChIKey | IHJOSICVABSICC-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|