C8H15F2NO — CID 103149207
5-(2,2-difluoroethoxy)-N-methylpent-1-en-3-amine (PubChem CID 103149207) has the molecular formula C8H15F2NO and a molecular weight of 179.21 g/mol. Its IUPAC name is 5-(2,2-difluoroethoxy)-N-methylpent-1-en-3-amine.
| Compound Name | 5-(2,2-difluoroethoxy)-N-methylpent-1-en-3-amine |
|---|---|
| PubChem CID | 103149207 |
| Molecular Formula | C8H15F2NO |
| Molecular Weight | 179.21 g/mol |
| Exact Mass | 179.11 |
| IUPAC Name | 5-(2,2-difluoroethoxy)-N-methylpent-1-en-3-amine |
| SMILES | C=CC(CCOCC(F)F)NC |
| InChI | InChI=1S/C8H15F2NO/c1-3-7(11-2)4-5-12-6-8(9)10/h3,7-8,11H,1,4-6H2,2H3 |
| InChIKey | WNYMJBCZBJQXSH-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.21 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|