C17H25F2NO — CID 103149325
4-(2,2-difluoroethoxy)-N-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-amine (PubChem CID 103149325) has the molecular formula C17H25F2NO and a molecular weight of 297.39 g/mol. Its IUPAC name is 4-(2,2-difluoroethoxy)-N-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-amine.
| Compound Name | 4-(2,2-difluoroethoxy)-N-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-amine |
|---|---|
| PubChem CID | 103149325 |
| Molecular Formula | C17H25F2NO |
| Molecular Weight | 297.39 g/mol |
| Exact Mass | 297.19 |
| IUPAC Name | 4-(2,2-difluoroethoxy)-N-methyl-1-(1,2,3,4-tetrahydronaphthalen-1-yl)butan-2-amine |
| SMILES | CNC(CCOCC(F)F)CC1CCCc2ccccc21 |
| InChI | InChI=1S/C17H25F2NO/c1-20-15(9-10-21-12-17(18)19)11-14-7-4-6-13-5-2-3-8-16(13)14/h2-3,5,8,14-15,17,20H,4,6-7,9-12H2,1H3 |
| InChIKey | HNHDFTTUSFDSGX-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.39 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|