C10H15F2N3O — CID 103149349
3-(2,2-difluoroethoxy)-N-methyl-1-pyrazin-2-ylpropan-1-amine (PubChem CID 103149349) has the molecular formula C10H15F2N3O and a molecular weight of 231.25 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-methyl-1-pyrazin-2-ylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-methyl-1-pyrazin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 103149349 |
| Molecular Formula | C10H15F2N3O |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.12 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-methyl-1-pyrazin-2-ylpropan-1-amine |
| SMILES | CNC(CCOCC(F)F)c1cnccn1 |
| InChI | InChI=1S/C10H15F2N3O/c1-13-8(2-5-16-7-10(11)12)9-6-14-3-4-15-9/h3-4,6,8,10,13H,2,5,7H2,1H3 |
| InChIKey | FVPFLYKKKDHWIJ-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|