C12H23F2NO — CID 103149668
1-(2,2-difluoroethoxy)-N-ethyl-6-methylhept-6-en-3-amine (PubChem CID 103149668) has the molecular formula C12H23F2NO and a molecular weight of 235.32 g/mol. Its IUPAC name is 1-(2,2-difluoroethoxy)-N-ethyl-6-methylhept-6-en-3-amine.
| Compound Name | 1-(2,2-difluoroethoxy)-N-ethyl-6-methylhept-6-en-3-amine |
|---|---|
| PubChem CID | 103149668 |
| Molecular Formula | C12H23F2NO |
| Molecular Weight | 235.32 g/mol |
| Exact Mass | 235.17 |
| IUPAC Name | 1-(2,2-difluoroethoxy)-N-ethyl-6-methylhept-6-en-3-amine |
| SMILES | C=C(C)CCC(CCOCC(F)F)NCC |
| InChI | InChI=1S/C12H23F2NO/c1-4-15-11(6-5-10(2)3)7-8-16-9-12(13)14/h11-12,15H,2,4-9H2,1,3H3 |
| InChIKey | WLDLQXMVYXLCLR-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|