C12H19F2N3O — CID 103149968
3-(2,2-difluoroethoxy)-N-propyl-1-pyrazin-2-ylpropan-1-amine (PubChem CID 103149968) has the molecular formula C12H19F2N3O and a molecular weight of 259.30 g/mol. Its IUPAC name is 3-(2,2-difluoroethoxy)-N-propyl-1-pyrazin-2-ylpropan-1-amine.
| Compound Name | 3-(2,2-difluoroethoxy)-N-propyl-1-pyrazin-2-ylpropan-1-amine |
|---|---|
| PubChem CID | 103149968 |
| Molecular Formula | C12H19F2N3O |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.15 |
| IUPAC Name | 3-(2,2-difluoroethoxy)-N-propyl-1-pyrazin-2-ylpropan-1-amine |
| SMILES | CCCNC(CCOCC(F)F)c1cnccn1 |
| InChI | InChI=1S/C12H19F2N3O/c1-2-4-16-10(3-7-18-9-12(13)14)11-8-15-5-6-17-11/h5-6,8,10,12,16H,2-4,7,9H2,1H3 |
| InChIKey | ZOBSUNJZWWJKJQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|