C13H19F2N3O — CID 103150832
[2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-6-yl]methanamine (PubChem CID 103150832) has the molecular formula C13H19F2N3O and a molecular weight of 271.31 g/mol. Its IUPAC name is [2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-6-yl]methanamine.
| Compound Name | [2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-6-yl]methanamine |
|---|---|
| PubChem CID | 103150832 |
| Molecular Formula | C13H19F2N3O |
| Molecular Weight | 271.31 g/mol |
| Exact Mass | 271.15 |
| IUPAC Name | [2-[2-(2,2-difluoroethoxy)ethyl]-5,6,7,8-tetrahydroquinazolin-6-yl]methanamine |
| SMILES | NCC1CCc2nc(CCOCC(F)F)ncc2C1 |
| InChI | InChI=1S/C13H19F2N3O/c14-12(15)8-19-4-3-13-17-7-10-5-9(6-16)1-2-11(10)18-13/h7,9,12H,1-6,8,16H2 |
| InChIKey | BVWKQFXOWLTQAL-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.31 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|