C19H30O3S — CID 10315103
2-(9-methoxy-9-phenylsulfanylnonyl)-1,3-dioxolane (PubChem CID 10315103) has the molecular formula C19H30O3S and a molecular weight of 338.51 g/mol. Its IUPAC name is 2-(9-methoxy-9-phenylsulfanylnonyl)-1,3-dioxolane.
| Compound Name | 2-(9-methoxy-9-phenylsulfanylnonyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 10315103 |
| Molecular Formula | C19H30O3S |
| Molecular Weight | 338.51 g/mol |
| Exact Mass | 338.19 |
| IUPAC Name | 2-(9-methoxy-9-phenylsulfanylnonyl)-1,3-dioxolane |
| SMILES | COC(CCCCCCCCC1OCCO1)Sc1ccccc1 |
| InChI | InChI=1S/C19H30O3S/c1-20-19(23-17-11-7-6-8-12-17)14-10-5-3-2-4-9-13-18-21-15-16-22-18/h6-8,11-12,18-19H,2-5,9-10,13-16H2,1H3 |
| InChIKey | OGQKOHAWPGJCLL-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.51 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|