C11H23F3N2O — CID 103151593
[6,6-dimethyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine (PubChem CID 103151593) has the molecular formula C11H23F3N2O and a molecular weight of 256.31 g/mol. Its IUPAC name is [6,6-dimethyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine.
| Compound Name | [6,6-dimethyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151593 |
| Molecular Formula | C11H23F3N2O |
| Molecular Weight | 256.31 g/mol |
| Exact Mass | 256.18 |
| IUPAC Name | [6,6-dimethyl-1-(2,2,2-trifluoroethoxy)heptan-3-yl]hydrazine |
| SMILES | CC(C)(C)CCC(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C11H23F3N2O/c1-10(2,3)6-4-9(16-15)5-7-17-8-11(12,13)14/h9,16H,4-8,15H2,1-3H3 |
| InChIKey | DCJVSPUUNBJRBN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.31 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|