C9H19F3N2O — CID 103151461
[4,4-dimethyl-1-(2,2,2-trifluoroethoxy)pentan-3-yl]hydrazine (PubChem CID 103151461) has the molecular formula C9H19F3N2O and a molecular weight of 228.26 g/mol. Its IUPAC name is [4,4-dimethyl-1-(2,2,2-trifluoroethoxy)pentan-3-yl]hydrazine.
| Compound Name | [4,4-dimethyl-1-(2,2,2-trifluoroethoxy)pentan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151461 |
| Molecular Formula | C9H19F3N2O |
| Molecular Weight | 228.26 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | [4,4-dimethyl-1-(2,2,2-trifluoroethoxy)pentan-3-yl]hydrazine |
| SMILES | CC(C)(C)C(CCOCC(F)(F)F)NN |
| InChI | InChI=1S/C9H19F3N2O/c1-8(2,3)7(14-13)4-5-15-6-9(10,11)12/h7,14H,4-6,13H2,1-3H3 |
| InChIKey | IDHZAIUZOBZSOF-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.26 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|