C9H17F3N2O3 — CID 155074480
[(3,3-dimethyloxan-4-yl)amino]azanium;2,2,2-trifluoroacetate (PubChem CID 155074480) has the molecular formula C9H17F3N2O3 and a molecular weight of 258.24 g/mol. Its IUPAC name is [(3,3-dimethyloxan-4-yl)amino]azanium;2,2,2-trifluoroacetate.
| Compound Name | [(3,3-dimethyloxan-4-yl)amino]azanium;2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 155074480 |
| Molecular Formula | C9H17F3N2O3 |
| Molecular Weight | 258.24 g/mol |
| Exact Mass | 258.12 |
| IUPAC Name | [(3,3-dimethyloxan-4-yl)amino]azanium;2,2,2-trifluoroacetate |
| SMILES | CC1(C)COCCC1N[NH3+].O=C([O-])C(F)(F)F |
| InChI | InChI=1S/C7H16N2O.C2HF3O2/c1-7(2)5-10-4-3-6(7)9-8;3-2(4,5)1(6)7/h6,9H,3-5,8H2,1-2H3;(H,6,7) |
| InChIKey | SEOZEZCLUHCDQH-UHFFFAOYSA-N |
| XLogP | -1.15 |
| TPSA | 89.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.24 |
| LogP ≤ 5 | -1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|