C9H20F2N2O — CID 103151779
[1-(2,2-difluoroethoxy)-5-methylhexan-3-yl]hydrazine (PubChem CID 103151779) has the molecular formula C9H20F2N2O and a molecular weight of 210.27 g/mol. Its IUPAC name is [1-(2,2-difluoroethoxy)-5-methylhexan-3-yl]hydrazine.
| Compound Name | [1-(2,2-difluoroethoxy)-5-methylhexan-3-yl]hydrazine |
|---|---|
| PubChem CID | 103151779 |
| Molecular Formula | C9H20F2N2O |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.15 |
| IUPAC Name | [1-(2,2-difluoroethoxy)-5-methylhexan-3-yl]hydrazine |
| SMILES | CC(C)CC(CCOCC(F)F)NN |
| InChI | InChI=1S/C9H20F2N2O/c1-7(2)5-8(13-12)3-4-14-6-9(10)11/h7-9,13H,3-6,12H2,1-2H3 |
| InChIKey | VOOQBPWSVIYMDQ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|