C10H16F2N2O2 — CID 103151764
[4-(2,2-difluoroethoxy)-1-(furan-3-yl)butan-2-yl]hydrazine (PubChem CID 103151764) has the molecular formula C10H16F2N2O2 and a molecular weight of 234.25 g/mol. Its IUPAC name is [4-(2,2-difluoroethoxy)-1-(furan-3-yl)butan-2-yl]hydrazine.
| Compound Name | [4-(2,2-difluoroethoxy)-1-(furan-3-yl)butan-2-yl]hydrazine |
|---|---|
| PubChem CID | 103151764 |
| Molecular Formula | C10H16F2N2O2 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.12 |
| IUPAC Name | [4-(2,2-difluoroethoxy)-1-(furan-3-yl)butan-2-yl]hydrazine |
| SMILES | NNC(CCOCC(F)F)Cc1ccoc1 |
| InChI | InChI=1S/C10H16F2N2O2/c11-10(12)7-16-4-2-9(14-13)5-8-1-3-15-6-8/h1,3,6,9-10,14H,2,4-5,7,13H2 |
| InChIKey | HMXFNLPLUGWJJY-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 60.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|