C11H22F2N2O — CID 103151930
[1-cyclohexyl-3-(2,2-difluoroethoxy)propyl]hydrazine (PubChem CID 103151930) has the molecular formula C11H22F2N2O and a molecular weight of 236.31 g/mol. Its IUPAC name is [1-cyclohexyl-3-(2,2-difluoroethoxy)propyl]hydrazine.
| Compound Name | [1-cyclohexyl-3-(2,2-difluoroethoxy)propyl]hydrazine |
|---|---|
| PubChem CID | 103151930 |
| Molecular Formula | C11H22F2N2O |
| Molecular Weight | 236.31 g/mol |
| Exact Mass | 236.17 |
| IUPAC Name | [1-cyclohexyl-3-(2,2-difluoroethoxy)propyl]hydrazine |
| SMILES | NNC(CCOCC(F)F)C1CCCCC1 |
| InChI | InChI=1S/C11H22F2N2O/c12-11(13)8-16-7-6-10(15-14)9-4-2-1-3-5-9/h9-11,15H,1-8,14H2 |
| InChIKey | WVDFMRMUDPCYRS-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|