C14H16N2O5 — CID 103153009
4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-3-methoxybutanoic acid (PubChem CID 103153009) has the molecular formula C14H16N2O5 and a molecular weight of 292.29 g/mol. Its IUPAC name is 4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-3-methoxybutanoic acid.
| Compound Name | 4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153009 |
| Molecular Formula | C14H16N2O5 |
| Molecular Weight | 292.29 g/mol |
| Exact Mass | 292.11 |
| IUPAC Name | 4-[[2-(1,2-benzoxazol-3-yl)acetyl]amino]-3-methoxybutanoic acid |
| SMILES | COC(CNC(=O)Cc1noc2ccccc12)CC(=O)O |
| InChI | InChI=1S/C14H16N2O5/c1-20-9(6-14(18)19)8-15-13(17)7-11-10-4-2-3-5-12(10)21-16-11/h2-5,9H,6-8H2,1H3,(H,15,17)(H,18,19) |
| InChIKey | AGKLUQOVRLUHNV-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.29 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |