C14H18BrNO5 — CID 103153136
4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]-3-methoxybutanoic acid (PubChem CID 103153136) has the molecular formula C14H18BrNO5 and a molecular weight of 360.20 g/mol. Its IUPAC name is 4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]-3-methoxybutanoic acid.
| Compound Name | 4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]-3-methoxybutanoic acid |
|---|---|
| PubChem CID | 103153136 |
| Molecular Formula | C14H18BrNO5 |
| Molecular Weight | 360.20 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | 4-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]-3-methoxybutanoic acid |
| SMILES | COC(CNC(=O)COc1ccc(C)cc1Br)CC(=O)O |
| InChI | InChI=1S/C14H18BrNO5/c1-9-3-4-12(11(15)5-9)21-8-13(17)16-7-10(20-2)6-14(18)19/h3-5,10H,6-8H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | PARNQZVIQLWUMG-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |