C13H20BrN2O2+ — CID 2184742
2-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]ethyl-dimethylazanium (PubChem CID 2184742) has the molecular formula C13H20BrN2O2+ and a molecular weight of 316.22 g/mol. Its IUPAC name is 2-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]ethyl-dimethylazanium.
| Compound Name | 2-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]ethyl-dimethylazanium |
|---|---|
| PubChem CID | 2184742 |
| Molecular Formula | C13H20BrN2O2+ |
| Molecular Weight | 316.22 g/mol |
| Exact Mass | 315.07 |
| IUPAC Name | 2-[[2-(2-bromo-4-methylphenoxy)acetyl]amino]ethyl-dimethylazanium |
| SMILES | Cc1ccc(OCC(=O)NCC[NH+](C)C)c(Br)c1 |
| InChI | InChI=1S/C13H19BrN2O2/c1-10-4-5-12(11(14)8-10)18-9-13(17)15-6-7-16(2)3/h4-5,8H,6-7,9H2,1-3H3,(H,15,17)/p+1 |
| InChIKey | GMVBTJRPRGEAHA-UHFFFAOYSA-O |
| XLogP | 0.40 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.22 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |