C16H23BrN2O3 — CID 5146954
2-(2-bromo-4-methylphenoxy)-N-(3-morpholin-4-ylpropyl)acetamide (PubChem CID 5146954) has the molecular formula C16H23BrN2O3 and a molecular weight of 371.28 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-(3-morpholin-4-ylpropyl)acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-(3-morpholin-4-ylpropyl)acetamide |
|---|---|
| PubChem CID | 5146954 |
| Molecular Formula | C16H23BrN2O3 |
| Molecular Weight | 371.28 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-(3-morpholin-4-ylpropyl)acetamide |
| SMILES | Cc1ccc(OCC(=O)NCCCN2CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C16H23BrN2O3/c1-13-3-4-15(14(17)11-13)22-12-16(20)18-5-2-6-19-7-9-21-10-8-19/h3-4,11H,2,5-10,12H2,1H3,(H,18,20) |
| InChIKey | MLTSWTCGYUMFEL-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.28 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|