C20H32N4O3S — CID 8626095
1-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea (PubChem CID 8626095) has the molecular formula C20H32N4O3S and a molecular weight of 408.57 g/mol. Its IUPAC name is 1-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea.
| Compound Name | 1-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea |
|---|---|
| PubChem CID | 8626095 |
| Molecular Formula | C20H32N4O3S |
| Molecular Weight | 408.57 g/mol |
| Exact Mass | 408.22 |
| IUPAC Name | 1-[[2-(5-methyl-2-propan-2-ylphenoxy)acetyl]amino]-3-(3-morpholin-4-ylpropyl)thiourea |
| SMILES | Cc1ccc(C(C)C)c(OCC(=O)NNC(=S)NCCCN2CCOCC2)c1 |
| InChI | InChI=1S/C20H32N4O3S/c1-15(2)17-6-5-16(3)13-18(17)27-14-19(25)22-23-20(28)21-7-4-8-24-9-11-26-12-10-24/h5-6,13,15H,4,7-12,14H2,1-3H3,(H,22,25)(H2,21,23,28) |
| InChIKey | SMHDGNKILYUNFE-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 74.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.57 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|