C15H20BrNO4 — CID 79037091
2-(2-bromo-4-methylphenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]acetamide (PubChem CID 79037091) has the molecular formula C15H20BrNO4 and a molecular weight of 358.23 g/mol. Its IUPAC name is 2-(2-bromo-4-methylphenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]acetamide.
| Compound Name | 2-(2-bromo-4-methylphenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]acetamide |
|---|---|
| PubChem CID | 79037091 |
| Molecular Formula | C15H20BrNO4 |
| Molecular Weight | 358.23 g/mol |
| Exact Mass | 357.06 |
| IUPAC Name | 2-(2-bromo-4-methylphenoxy)-N-[(4-hydroxyoxan-4-yl)methyl]acetamide |
| SMILES | Cc1ccc(OCC(=O)NCC2(O)CCOCC2)c(Br)c1 |
| InChI | InChI=1S/C15H20BrNO4/c1-11-2-3-13(12(16)8-11)21-9-14(18)17-10-15(19)4-6-20-7-5-15/h2-3,8,19H,4-7,9-10H2,1H3,(H,17,18) |
| InChIKey | RHXRXILSYQGOGT-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 67.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.23 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |