C15H18F3N3O3 — CID 10315534
2,2,2-trifluoro-N-methyl-N-[(1S)-1-(4-nitrophenyl)-2-pyrrolidin-1-ylethyl]acetamide (PubChem CID 10315534) has the molecular formula C15H18F3N3O3 and a molecular weight of 345.32 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-methyl-N-[(1S)-1-(4-nitrophenyl)-2-pyrrolidin-1-ylethyl]acetamide.
| Compound Name | 2,2,2-trifluoro-N-methyl-N-[(1S)-1-(4-nitrophenyl)-2-pyrrolidin-1-ylethyl]acetamide |
|---|---|
| PubChem CID | 10315534 |
| Molecular Formula | C15H18F3N3O3 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2,2,2-trifluoro-N-methyl-N-[(1S)-1-(4-nitrophenyl)-2-pyrrolidin-1-ylethyl]acetamide |
| SMILES | CN(C(=O)C(F)(F)F)[C@H](CN1CCCC1)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C15H18F3N3O3/c1-19(14(22)15(16,17)18)13(10-20-8-2-3-9-20)11-4-6-12(7-5-11)21(23)24/h4-7,13H,2-3,8-10H2,1H3/t13-/m1/s1 |
| InChIKey | QVZMGXYHCNWADN-CYBMUJFWSA-N |
| XLogP | 2.75 |
| TPSA | 66.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|