C24H28ClN3O5 — CID 11317462
[2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate;hydrochloride (PubChem CID 11317462) has the molecular formula C24H28ClN3O5 and a molecular weight of 473.96 g/mol. Its IUPAC name is [2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate;hydrochloride.
| Compound Name | [2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 11317462 |
| Molecular Formula | C24H28ClN3O5 |
| Molecular Weight | 473.96 g/mol |
| Exact Mass | 473.17 |
| IUPAC Name | [2-[methyl-[(1S)-1-phenyl-2-pyrrolidin-1-ylethyl]amino]-2-oxoethyl] (E)-3-(2-nitrophenyl)prop-2-enoate;hydrochloride |
| SMILES | CN(C(=O)COC(=O)/C=C/c1ccccc1[N+](=O)[O-])[C@H](CN1CCCC1)c1ccccc1.Cl |
| InChI | InChI=1S/C24H27N3O5.ClH/c1-25(22(17-26-15-7-8-16-26)19-9-3-2-4-10-19)23(28)18-32-24(29)14-13-20-11-5-6-12-21(20)27(30)31;/h2-6,9-14,22H,7-8,15-18H2,1H3;1H/b14-13+;/t22-;/m1./s1 |
| InChIKey | IZTRZGHMUKAHEO-BOOBJNPKSA-N |
| XLogP | 3.87 |
| TPSA | 92.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.96 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|