C9H17F3N2O2 — CID 103156466
4-amino-3-methoxy-N-(4,4,4-trifluorobutyl)butanamide (PubChem CID 103156466) has the molecular formula C9H17F3N2O2 and a molecular weight of 242.24 g/mol. Its IUPAC name is 4-amino-3-methoxy-N-(4,4,4-trifluorobutyl)butanamide.
| Compound Name | 4-amino-3-methoxy-N-(4,4,4-trifluorobutyl)butanamide |
|---|---|
| PubChem CID | 103156466 |
| Molecular Formula | C9H17F3N2O2 |
| Molecular Weight | 242.24 g/mol |
| Exact Mass | 242.12 |
| IUPAC Name | 4-amino-3-methoxy-N-(4,4,4-trifluorobutyl)butanamide |
| SMILES | COC(CN)CC(=O)NCCCC(F)(F)F |
| InChI | InChI=1S/C9H17F3N2O2/c1-16-7(6-13)5-8(15)14-4-2-3-9(10,11)12/h7H,2-6,13H2,1H3,(H,14,15) |
| InChIKey | FUNPDSRVRHNJNP-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.24 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|