C9H16N2O2 — CID 103156644
4-amino-N-but-2-ynyl-3-methoxybutanamide (PubChem CID 103156644) has the molecular formula C9H16N2O2 and a molecular weight of 184.24 g/mol. Its IUPAC name is 4-amino-N-but-2-ynyl-3-methoxybutanamide.
| Compound Name | 4-amino-N-but-2-ynyl-3-methoxybutanamide |
|---|---|
| PubChem CID | 103156644 |
| Molecular Formula | C9H16N2O2 |
| Molecular Weight | 184.24 g/mol |
| Exact Mass | 184.12 |
| IUPAC Name | 4-amino-N-but-2-ynyl-3-methoxybutanamide |
| SMILES | CC#CCNC(=O)CC(CN)OC |
| InChI | InChI=1S/C9H16N2O2/c1-3-4-5-11-9(12)6-8(7-10)13-2/h8H,5-7,10H2,1-2H3,(H,11,12) |
| InChIKey | YVVHMYOKUPQMCD-UHFFFAOYSA-N |
| XLogP | -0.51 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.24 |
| LogP ≤ 5 | -0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|